C14H12ClN3O2S2 — CID 170949549
3-[5-[(3-chloro-1H-indol-7-yl)amino]sulfanyl-1,3-thiazol-2-yl]oxetan-3-ol (PubChem CID 170949549) has the molecular formula C14H12ClN3O2S2 and a molecular weight of 353.86 g/mol. Its IUPAC name is 3-[5-[(3-chloro-1H-indol-7-yl)amino]sulfanyl-1,3-thiazol-2-yl]oxetan-3-ol.
| Compound Name | 3-[5-[(3-chloro-1H-indol-7-yl)amino]sulfanyl-1,3-thiazol-2-yl]oxetan-3-ol |
|---|---|
| PubChem CID | 170949549 |
| Molecular Formula | C14H12ClN3O2S2 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 3-[5-[(3-chloro-1H-indol-7-yl)amino]sulfanyl-1,3-thiazol-2-yl]oxetan-3-ol |
| SMILES | OC1(c2ncc(SNc3cccc4c(Cl)c[nH]c34)s2)COC1 |
| InChI | InChI=1S/C14H12ClN3O2S2/c15-9-4-16-12-8(9)2-1-3-10(12)18-22-11-5-17-13(21-11)14(19)6-20-7-14/h1-5,16,18-19H,6-7H2 |
| InChIKey | AHHRTYWKXDAHHK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|