C10H14N2O2 — CID 169183444
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)prop-2-ynamide (PubChem CID 169183444) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)prop-2-ynamide.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 169183444 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)prop-2-ynamide |
| SMILES | NC(=O)C#CC1CCC2COCCN12 |
| InChI | InChI=1S/C10H14N2O2/c11-10(13)4-3-8-1-2-9-7-14-6-5-12(8)9/h8-9H,1-2,5-7H2,(H2,11,13) |
| InChIKey | OITUFIYDRFDSAF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|