C25H32F3N3O4 — CID 169191054
(3R)-3-[5-[[(2R,3S)-3-[(4,4-difluorocyclohexyl)amino]oxan-2-yl]methyl]-4-fluoro-1-hydroxy-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 169191054) has the molecular formula C25H32F3N3O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is (3R)-3-[5-[[(2R,3S)-3-[(4,4-difluorocyclohexyl)amino]oxan-2-yl]methyl]-4-fluoro-1-hydroxy-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[5-[[(2R,3S)-3-[(4,4-difluorocyclohexyl)amino]oxan-2-yl]methyl]-4-fluoro-1-hydroxy-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169191054 |
| Molecular Formula | C25H32F3N3O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (3R)-3-[5-[[(2R,3S)-3-[(4,4-difluorocyclohexyl)amino]oxan-2-yl]methyl]-4-fluoro-1-hydroxy-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2Cc3c(ccc(C[C@H]4OCCC[C@@H]4NC4CCC(F)(F)CC4)c3F)C2O)C(=O)N1 |
| InChI | InChI=1S/C25H32F3N3O4/c26-22-14(12-20-18(2-1-11-35-20)29-15-7-9-25(27,28)10-8-15)3-4-16-17(22)13-31(24(16)34)19-5-6-21(32)30-23(19)33/h3-4,15,18-20,24,29,34H,1-2,5-13H2,(H,30,32,33)/t18-,19+,20+,24?/m0/s1 |
| InChIKey | HBIPWSDJPXYNOD-SLLHVTCXSA-N |
| XLogP | 2.69 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|