C13H19N — CID 169193360
7-(2-methylpropyl)-5,6,7,8-tetrahydroisoquinoline (PubChem CID 169193360) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 7-(2-methylpropyl)-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 7-(2-methylpropyl)-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 169193360 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 7-(2-methylpropyl)-5,6,7,8-tetrahydroisoquinoline |
| SMILES | CC(C)CC1CCc2ccncc2C1 |
| InChI | InChI=1S/C13H19N/c1-10(2)7-11-3-4-12-5-6-14-9-13(12)8-11/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | IBAKWRKQYYDUIN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |