C24H28F3N3O4 — CID 169200173
(12R)-4,12-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide;ethane (PubChem CID 169200173) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is (12R)-4,12-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide;ethane.
| Compound Name | (12R)-4,12-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide;ethane |
|---|---|
| PubChem CID | 169200173 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (12R)-4,12-dimethyl-2,5-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-11-oxa-1,8-diazatricyclo[8.5.0.03,8]pentadeca-3,6-diene-6-carboxamide;ethane |
| SMILES | CC.Cc1c2n(cc(C(=O)NCc3c(F)cc(F)cc3F)c1=O)CC1O[C@H](C)CCCN1C2=O |
| InChI | InChI=1S/C22H22F3N3O4.C2H6/c1-11-4-3-5-28-18(32-11)10-27-9-15(20(29)12(2)19(27)22(28)31)21(30)26-8-14-16(24)6-13(23)7-17(14)25;1-2/h6-7,9,11,18H,3-5,8,10H2,1-2H3,(H,26,30);1-2H3/t11-,18?;/m1./s1 |
| InChIKey | QLXSGUXKJZTBHX-QPSJMSKFSA-N |
| XLogP | 3.51 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |