C20H18F3N5O — CID 169200929
5-phenyl-N-[2-[2-(trifluoromethyl)morpholin-4-yl]-4-pyridinyl]pyridazin-3-amine (PubChem CID 169200929) has the molecular formula C20H18F3N5O and a molecular weight of 401.39 g/mol. Its IUPAC name is 5-phenyl-N-[2-[2-(trifluoromethyl)morpholin-4-yl]-4-pyridinyl]pyridazin-3-amine.
| Compound Name | 5-phenyl-N-[2-[2-(trifluoromethyl)morpholin-4-yl]-4-pyridinyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 169200929 |
| Molecular Formula | C20H18F3N5O |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 5-phenyl-N-[2-[2-(trifluoromethyl)morpholin-4-yl]-4-pyridinyl]pyridazin-3-amine |
| SMILES | FC(F)(F)C1CN(c2cc(Nc3cc(-c4ccccc4)cnn3)ccn2)CCO1 |
| InChI | InChI=1S/C20H18F3N5O/c21-20(22,23)17-13-28(8-9-29-17)19-11-16(6-7-24-19)26-18-10-15(12-25-27-18)14-4-2-1-3-5-14/h1-7,10-12,17H,8-9,13H2,(H,24,26,27) |
| InChIKey | HNNOSISLLZOVEX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |