C15H18ClN3O3 — CID 169206856
5-chloro-1-(oxan-2-yl)-3-propan-2-yloxypyrazolo[4,5-b]pyridine-7-carbaldehyde (PubChem CID 169206856) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 5-chloro-1-(oxan-2-yl)-3-propan-2-yloxypyrazolo[4,5-b]pyridine-7-carbaldehyde.
| Compound Name | 5-chloro-1-(oxan-2-yl)-3-propan-2-yloxypyrazolo[4,5-b]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 169206856 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-chloro-1-(oxan-2-yl)-3-propan-2-yloxypyrazolo[4,5-b]pyridine-7-carbaldehyde |
| SMILES | CC(C)Oc1nn(C2CCCCO2)c2c(C=O)cc(Cl)nc12 |
| InChI | InChI=1S/C15H18ClN3O3/c1-9(2)22-15-13-14(10(8-20)7-11(16)17-13)19(18-15)12-5-3-4-6-21-12/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | ZVGBTNOLIVPATD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|