C17H32N2O — CID 169208625
(1E,5Z,7Z)-N-[6-(ethylamino)hexyl]cycloocta-1,5,7-triene-1-carboxamide;molecular hydrogen (PubChem CID 169208625) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is (1E,5Z,7Z)-N-[6-(ethylamino)hexyl]cycloocta-1,5,7-triene-1-carboxamide;molecular hydrogen.
| Compound Name | (1E,5Z,7Z)-N-[6-(ethylamino)hexyl]cycloocta-1,5,7-triene-1-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 169208625 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | (1E,5Z,7Z)-N-[6-(ethylamino)hexyl]cycloocta-1,5,7-triene-1-carboxamide;molecular hydrogen |
| SMILES | CCNCCCCCCNC(=O)C1=C/CC/C=C/C=C\1.[H][H].[H][H] |
| InChI | InChI=1S/C17H28N2O.2H2/c1-2-18-14-10-6-7-11-15-19-17(20)16-12-8-4-3-5-9-13-16;;/h3-4,8,12-13,18H,2,5-7,9-11,14-15H2,1H3,(H,19,20);2*1H/b4-3-,12-8-,16-13+;; |
| InChIKey | NMRJIVIUPFOMMW-RHDKWHLOSA-N |
| XLogP | 3.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|