C15H25N3O — CID 177166188
(1E,5Z,7Z)-N-(6-hydrazinylhexyl)cycloocta-1,5,7-triene-1-carboxamide (PubChem CID 177166188) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (1E,5Z,7Z)-N-(6-hydrazinylhexyl)cycloocta-1,5,7-triene-1-carboxamide.
| Compound Name | (1E,5Z,7Z)-N-(6-hydrazinylhexyl)cycloocta-1,5,7-triene-1-carboxamide |
|---|---|
| PubChem CID | 177166188 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (1E,5Z,7Z)-N-(6-hydrazinylhexyl)cycloocta-1,5,7-triene-1-carboxamide |
| SMILES | NNCCCCCCNC(=O)C1=C/CC/C=C/C=C\1 |
| InChI | InChI=1S/C15H25N3O/c16-18-13-9-5-4-8-12-17-15(19)14-10-6-2-1-3-7-11-14/h1-2,6,10-11,18H,3-5,7-9,12-13,16H2,(H,17,19)/b2-1-,10-6-,14-11+ |
| InChIKey | RBXLATQPUHDSJZ-NWBZXLDSSA-N |
| XLogP | 1.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|