C6H6F2N+ — CID 169211033
2,4-difluoro-1-methylpyridin-1-ium (PubChem CID 169211033) has the molecular formula C6H6F2N+ and a molecular weight of 130.12 g/mol. Its IUPAC name is 2,4-difluoro-1-methylpyridin-1-ium.
| Compound Name | 2,4-difluoro-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169211033 |
| Molecular Formula | C6H6F2N+ |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 2,4-difluoro-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(F)cc1F |
| InChI | InChI=1S/C6H6F2N/c1-9-3-2-5(7)4-6(9)8/h2-4H,1H3/q+1 |
| InChIKey | JZCZGWPJUBCGSB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|