C17H16N4O2S — CID 169214322
(1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl) N-phenylcarbamate (PubChem CID 169214322) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is (1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl) N-phenylcarbamate.
| Compound Name | (1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl) N-phenylcarbamate |
|---|---|
| PubChem CID | 169214322 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-yl) N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OC1CCN(c2ncnc3sccc23)C1 |
| InChI | InChI=1S/C17H16N4O2S/c22-17(20-12-4-2-1-3-5-12)23-13-6-8-21(10-13)15-14-7-9-24-16(14)19-11-18-15/h1-5,7,9,11,13H,6,8,10H2,(H,20,22) |
| InChIKey | YZDZDEDVKJIIIV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |