C15H17ClF2N2O2 — CID 169216736
3-chloro-2,5-difluoro-N-[[2-(hydroxymethyl)-2-azaspiro[3.3]heptan-6-yl]methyl]benzamide (PubChem CID 169216736) has the molecular formula C15H17ClF2N2O2 and a molecular weight of 330.76 g/mol. Its IUPAC name is 3-chloro-2,5-difluoro-N-[[2-(hydroxymethyl)-2-azaspiro[3.3]heptan-6-yl]methyl]benzamide.
| Compound Name | 3-chloro-2,5-difluoro-N-[[2-(hydroxymethyl)-2-azaspiro[3.3]heptan-6-yl]methyl]benzamide |
|---|---|
| PubChem CID | 169216736 |
| Molecular Formula | C15H17ClF2N2O2 |
| Molecular Weight | 330.76 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-chloro-2,5-difluoro-N-[[2-(hydroxymethyl)-2-azaspiro[3.3]heptan-6-yl]methyl]benzamide |
| SMILES | O=C(NCC1CC2(C1)CN(CO)C2)c1cc(F)cc(Cl)c1F |
| InChI | InChI=1S/C15H17ClF2N2O2/c16-12-2-10(17)1-11(13(12)18)14(22)19-5-9-3-15(4-9)6-20(7-15)8-21/h1-2,9,21H,3-8H2,(H,19,22) |
| InChIKey | VVZPUGLVNRVQBZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|