C12H12ClF3N2 — CID 169217994
(E)-1-[5-chloro-2-(methylideneamino)phenyl]-4,4,4-trifluoro-N-methylbut-1-en-1-amine (PubChem CID 169217994) has the molecular formula C12H12ClF3N2 and a molecular weight of 276.69 g/mol. Its IUPAC name is (E)-1-[5-chloro-2-(methylideneamino)phenyl]-4,4,4-trifluoro-N-methylbut-1-en-1-amine.
| Compound Name | (E)-1-[5-chloro-2-(methylideneamino)phenyl]-4,4,4-trifluoro-N-methylbut-1-en-1-amine |
|---|---|
| PubChem CID | 169217994 |
| Molecular Formula | C12H12ClF3N2 |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (E)-1-[5-chloro-2-(methylideneamino)phenyl]-4,4,4-trifluoro-N-methylbut-1-en-1-amine |
| SMILES | C=Nc1ccc(Cl)cc1/C(=C\CC(F)(F)F)NC |
| InChI | InChI=1S/C12H12ClF3N2/c1-17-10-4-3-8(13)7-9(10)11(18-2)5-6-12(14,15)16/h3-5,7,18H,1,6H2,2H3/b11-5+ |
| InChIKey | FLXSJKZHOBLPFP-VZUCSPMQSA-N |
| XLogP | 4.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|