C27H22F2NO8PS — CID 169219146
(4-nitrophenyl) 5-[difluoro-[(2-oxo-2-propan-2-yloxyethoxy)-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 169219146) has the molecular formula C27H22F2NO8PS and a molecular weight of 589.51 g/mol. Its IUPAC name is (4-nitrophenyl) 5-[difluoro-[(2-oxo-2-propan-2-yloxyethoxy)-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | (4-nitrophenyl) 5-[difluoro-[(2-oxo-2-propan-2-yloxyethoxy)-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 169219146 |
| Molecular Formula | C27H22F2NO8PS |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | (4-nitrophenyl) 5-[difluoro-[(2-oxo-2-propan-2-yloxyethoxy)-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | CC(C)OC(=O)COP(Oc1ccccc1)C(F)(F)c1ccc2sc(C(=O)Oc3ccc([N+](=O)[O-])cc3)cc2c1 |
| InChI | InChI=1S/C27H22F2NO8PS/c1-17(2)36-25(31)16-35-39(38-22-6-4-3-5-7-22)27(28,29)19-8-13-23-18(14-19)15-24(40-23)26(32)37-21-11-9-20(10-12-21)30(33)34/h3-15,17H,16H2,1-2H3 |
| InChIKey | KSCTWJKWCPJPOH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|