C30H34F2NO8PS3 — CID 168981930
(4-nitrophenyl) 5-[bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl-difluoromethyl]-1-benzothiophene-2-carboxylate (PubChem CID 168981930) has the molecular formula C30H34F2NO8PS3 and a molecular weight of 701.77 g/mol. Its IUPAC name is (4-nitrophenyl) 5-[bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl-difluoromethyl]-1-benzothiophene-2-carboxylate.
| Compound Name | (4-nitrophenyl) 5-[bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl-difluoromethyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168981930 |
| Molecular Formula | C30H34F2NO8PS3 |
| Molecular Weight | 701.77 g/mol |
| Exact Mass | 701.12 |
| IUPAC Name | (4-nitrophenyl) 5-[bis[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl-difluoromethyl]-1-benzothiophene-2-carboxylate |
| SMILES | CC(C)(C)C(=O)SCCOP(OCCSC(=O)C(C)(C)C)C(F)(F)c1ccc2sc(C(=O)Oc3ccc([N+](=O)[O-])cc3)cc2c1 |
| InChI | InChI=1S/C30H34F2NO8PS3/c1-28(2,3)26(35)43-15-13-39-42(40-14-16-44-27(36)29(4,5)6)30(31,32)20-7-12-23-19(17-20)18-24(45-23)25(34)41-22-10-8-21(9-11-22)33(37)38/h7-12,17-18H,13-16H2,1-6H3 |
| InChIKey | RHDCDRGMDJFTNP-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.77 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|