C11H13FN2O — CID 169221984
N'-(3-fluorophenyl)cyclobutanecarbohydrazide (PubChem CID 169221984) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is N'-(3-fluorophenyl)cyclobutanecarbohydrazide.
| Compound Name | N'-(3-fluorophenyl)cyclobutanecarbohydrazide |
|---|---|
| PubChem CID | 169221984 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N'-(3-fluorophenyl)cyclobutanecarbohydrazide |
| SMILES | O=C(NNc1cccc(F)c1)C1CCC1 |
| InChI | InChI=1S/C11H13FN2O/c12-9-5-2-6-10(7-9)13-14-11(15)8-3-1-4-8/h2,5-8,13H,1,3-4H2,(H,14,15) |
| InChIKey | FUZYRNBUOQSGIQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|