C20H16F3NO — CID 169224955
1-methyl-2-oxido-4-phenyl-3-prop-1-en-2-yl-6-(trifluoromethyl)isoquinolin-2-ium (PubChem CID 169224955) has the molecular formula C20H16F3NO and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-methyl-2-oxido-4-phenyl-3-prop-1-en-2-yl-6-(trifluoromethyl)isoquinolin-2-ium.
| Compound Name | 1-methyl-2-oxido-4-phenyl-3-prop-1-en-2-yl-6-(trifluoromethyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 169224955 |
| Molecular Formula | C20H16F3NO |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-methyl-2-oxido-4-phenyl-3-prop-1-en-2-yl-6-(trifluoromethyl)isoquinolin-2-ium |
| SMILES | C=C(C)c1c(-c2ccccc2)c2cc(C(F)(F)F)ccc2c(C)[n+]1[O-] |
| InChI | InChI=1S/C20H16F3NO/c1-12(2)19-18(14-7-5-4-6-8-14)17-11-15(20(21,22)23)9-10-16(17)13(3)24(19)25/h4-11H,1H2,2-3H3 |
| InChIKey | BYINMEBKVJCMRP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|