C11H17NO2 — CID 169228077
methyl 2-azatricyclo[5.2.1.02,6]decane-6-carboxylate (PubChem CID 169228077) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl 2-azatricyclo[5.2.1.02,6]decane-6-carboxylate.
| Compound Name | methyl 2-azatricyclo[5.2.1.02,6]decane-6-carboxylate |
|---|---|
| PubChem CID | 169228077 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methyl 2-azatricyclo[5.2.1.02,6]decane-6-carboxylate |
| SMILES | COC(=O)C12CCCN1C1CCC2C1 |
| InChI | InChI=1S/C11H17NO2/c1-14-10(13)11-5-2-6-12(11)9-4-3-8(11)7-9/h8-9H,2-7H2,1H3 |
| InChIKey | FBZSIBIUCAOONR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |