C18H27N6O5+ — CID 169234373
[[amino-[5-[(2R,3R,4S,5R)-5-[[(2R)-2-amino-3,3-dimethylbutanoyl]oxymethyl]-2-cyano-3,4-dihydroxyoxolan-2-yl]-1H-pyrrol-2-yl]methylidene]amino]methylideneazanium (PubChem CID 169234373) has the molecular formula C18H27N6O5+ and a molecular weight of 407.45 g/mol. Its IUPAC name is [[amino-[5-[(2R,3R,4S,5R)-5-[[(2R)-2-amino-3,3-dimethylbutanoyl]oxymethyl]-2-cyano-3,4-dihydroxyoxolan-2-yl]-1H-pyrrol-2-yl]methylidene]amino]methylideneazanium.
| Compound Name | [[amino-[5-[(2R,3R,4S,5R)-5-[[(2R)-2-amino-3,3-dimethylbutanoyl]oxymethyl]-2-cyano-3,4-dihydroxyoxolan-2-yl]-1H-pyrrol-2-yl]methylidene]amino]methylideneazanium |
|---|---|
| PubChem CID | 169234373 |
| Molecular Formula | C18H27N6O5+ |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [[amino-[5-[(2R,3R,4S,5R)-5-[[(2R)-2-amino-3,3-dimethylbutanoyl]oxymethyl]-2-cyano-3,4-dihydroxyoxolan-2-yl]-1H-pyrrol-2-yl]methylidene]amino]methylideneazanium |
| SMILES | CC(C)(C)[C@@H](N)C(=O)OC[C@H]1O[C@@](C#N)(c2ccc(/C(N)=N/C=[NH2+])[nH]2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26N6O5/c1-17(2,3)13(21)16(27)28-6-10-12(25)14(26)18(7-19,29-10)11-5-4-9(24-11)15(22)23-8-20/h4-5,8,10,12-14,24-26H,6,21H2,1-3H3,(H3,20,22,23)/p+1/t10-,12-,13+,14-,18+/m1/s1 |
| InChIKey | GKWPXSKYLYUENN-AXOAAPQKSA-O |
| XLogP | -2.74 |
| TPSA | 205.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|