C23H16ClF2N3O4 — CID 169235040
N-[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-5-fluoro-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzofuran-3-carboxamide (PubChem CID 169235040) has the molecular formula C23H16ClF2N3O4 and a molecular weight of 471.85 g/mol. Its IUPAC name is N-[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-5-fluoro-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzofuran-3-carboxamide.
| Compound Name | N-[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-5-fluoro-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 169235040 |
| Molecular Formula | C23H16ClF2N3O4 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-5-fluoro-6-[(Z)-N'-hydroxycarbamimidoyl]-1-benzofuran-3-carboxamide |
| SMILES | N/C(=N\O)c1cc2occ(C(=O)Nc3ccc(OCc4ccc(F)cc4Cl)cc3)c2cc1F |
| InChI | InChI=1S/C23H16ClF2N3O4/c24-19-7-13(25)2-1-12(19)10-32-15-5-3-14(4-6-15)28-23(30)18-11-33-21-9-17(22(27)29-31)20(26)8-16(18)21/h1-9,11,31H,10H2,(H2,27,29)(H,28,30) |
| InChIKey | IHDCQNXHGCHYIG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|