About 5,5-dioctoxypent-1-en-2-ol
5,5-dioctoxypent-1-en-2-ol (PubChem CID 169237184) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is 5,5-dioctoxypent-1-en-2-ol.
Molecular Properties
| Compound Name | 5,5-dioctoxypent-1-en-2-ol |
| PubChem CID | 169237184 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 5,5-dioctoxypent-1-en-2-ol |
| SMILES | C=C(O)CCC(OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C21H42O3/c1-4-6-8-10-12-14-18-23-21(17-16-20(3)22)24-19-15-13-11-9-7-5-2/h21-22H,3-19H2,1-2H3 |
| InChIKey | ASZVDMIOHXZZJJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dioctoxypent-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dioctoxypent-1-en-2-ol?
The IUPAC name of 5,5-dioctoxypent-1-en-2-ol (CID 169237184) is 5,5-dioctoxypent-1-en-2-ol.
What is the SMILES notation for 5,5-dioctoxypent-1-en-2-ol?
The canonical SMILES for 5,5-dioctoxypent-1-en-2-ol is C=C(O)CCC(OCCCCCCCC)OCCCCCCCC.
What is the InChIKey of 5,5-dioctoxypent-1-en-2-ol?
The InChIKey is ASZVDMIOHXZZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O3/c1-4-6-8-10-12-14-18-23-21(17-16-20(3)22)24-19-15-13-11-9-7-5-2/h21-22H,3-19H2,1-2H3.
What are the key properties of 5,5-dioctoxypent-1-en-2-ol?
5,5-dioctoxypent-1-en-2-ol has a molecular weight of 342.56 g/mol, XLogP of 6.92, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dioctoxypent-1-en-2-ol is sourced from PubChem (CID 169237184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).