C19H22O — CID 169239333
4-[(Z)-1-(2,4-dimethylphenyl)pent-1-enyl]phenol (PubChem CID 169239333) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-[(Z)-1-(2,4-dimethylphenyl)pent-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-(2,4-dimethylphenyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 169239333 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-[(Z)-1-(2,4-dimethylphenyl)pent-1-enyl]phenol |
| SMILES | CCC/C=C(/c1ccc(O)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C19H22O/c1-4-5-6-19(16-8-10-17(20)11-9-16)18-12-7-14(2)13-15(18)3/h6-13,20H,4-5H2,1-3H3/b19-6- |
| InChIKey | OWEVHKOSAQMLMT-SWNXQHNESA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |