C28H25ClF6N4O2 — CID 169240807
2-chloro-6-(cyclopropyliminomethyl)-4-[2-[3-(difluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]aniline;formamide (PubChem CID 169240807) has the molecular formula C28H25ClF6N4O2 and a molecular weight of 598.98 g/mol. Its IUPAC name is 2-chloro-6-(cyclopropyliminomethyl)-4-[2-[3-(difluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]aniline;formamide.
| Compound Name | 2-chloro-6-(cyclopropyliminomethyl)-4-[2-[3-(difluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]aniline;formamide |
|---|---|
| PubChem CID | 169240807 |
| Molecular Formula | C28H25ClF6N4O2 |
| Molecular Weight | 598.98 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 2-chloro-6-(cyclopropyliminomethyl)-4-[2-[3-(difluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]aniline;formamide |
| SMILES | NC=O.Nc1c(Cl)cc(CC(c2cc3c(c(-c4ccc(F)cc4)n2)OCC3C(F)F)C(F)(F)F)cc1/C=N/C1CC1 |
| InChI | InChI=1S/C27H22ClF6N3O.CH3NO/c28-21-9-13(7-15(23(21)35)11-36-17-5-6-17)8-20(27(32,33)34)22-10-18-19(26(30)31)12-38-25(18)24(37-22)14-1-3-16(29)4-2-14;2-1-3/h1-4,7,9-11,17,19-20,26H,5-6,8,12,35H2;1H,(H2,2,3)/b36-11+; |
| InChIKey | XHERVMOXDICCGQ-SJXUZJPVSA-N |
| XLogP | 6.44 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.98 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|