C28H29ClF5N5O4 — CID 169240877
4-[2-[7-[3-chloro-4-(trifluoromethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-2-[(E)-difluoromethyliminomethyl]-6-methoxyaniline;formamide (PubChem CID 169240877) has the molecular formula C28H29ClF5N5O4 and a molecular weight of 630.01 g/mol. Its IUPAC name is 4-[2-[7-[3-chloro-4-(trifluoromethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-2-[(E)-difluoromethyliminomethyl]-6-methoxyaniline;formamide.
| Compound Name | 4-[2-[7-[3-chloro-4-(trifluoromethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-2-[(E)-difluoromethyliminomethyl]-6-methoxyaniline;formamide |
|---|---|
| PubChem CID | 169240877 |
| Molecular Formula | C28H29ClF5N5O4 |
| Molecular Weight | 630.01 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | 4-[2-[7-[3-chloro-4-(trifluoromethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-2-[(E)-difluoromethyliminomethyl]-6-methoxyaniline;formamide |
| SMILES | COc1cc(CCc2cc3c(c(-c4ccc(C(F)(F)F)c(Cl)c4)n2)OCC3C)cc(/C=N/C(F)F)c1N.NC=O.NC=O |
| InChI | InChI=1S/C26H23ClF5N3O2.2CH3NO/c1-13-12-37-24-18(13)10-17(35-23(24)15-4-6-19(20(27)9-15)26(30,31)32)5-3-14-7-16(11-34-25(28)29)22(33)21(8-14)36-2;2*2-1-3/h4,6-11,13,25H,3,5,12,33H2,1-2H3;2*1H,(H2,2,3)/b34-11+;; |
| InChIKey | QYKDVAIAEATQEB-STUJZEDDSA-N |
| XLogP | 5.14 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|