C19H30N2O — CID 169244209
2-(1-cyclopentyl-5-methoxy-3-methyl-2H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 169244209) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-(1-cyclopentyl-5-methoxy-3-methyl-2H-indol-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(1-cyclopentyl-5-methoxy-3-methyl-2H-indol-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 169244209 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 2-(1-cyclopentyl-5-methoxy-3-methyl-2H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | COc1ccc2c(c1)C(C)(CCN(C)C)CN2C1CCCC1 |
| InChI | InChI=1S/C19H30N2O/c1-19(11-12-20(2)3)14-21(15-7-5-6-8-15)18-10-9-16(22-4)13-17(18)19/h9-10,13,15H,5-8,11-12,14H2,1-4H3 |
| InChIKey | XZRLLIWZENCDCE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|