C19H32N2O — CID 169244325
N-[2-[(3S)-5-methoxy-1,3-dimethyl-2H-indol-3-yl]ethyl]-N-propan-2-ylpropan-2-amine (PubChem CID 169244325) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N-[2-[(3S)-5-methoxy-1,3-dimethyl-2H-indol-3-yl]ethyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[2-[(3S)-5-methoxy-1,3-dimethyl-2H-indol-3-yl]ethyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 169244325 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N-[2-[(3S)-5-methoxy-1,3-dimethyl-2H-indol-3-yl]ethyl]-N-propan-2-ylpropan-2-amine |
| SMILES | COc1ccc2c(c1)[C@](C)(CCN(C(C)C)C(C)C)CN2C |
| InChI | InChI=1S/C19H32N2O/c1-14(2)21(15(3)4)11-10-19(5)13-20(6)18-9-8-16(22-7)12-17(18)19/h8-9,12,14-15H,10-11,13H2,1-7H3/t19-/m1/s1 |
| InChIKey | KUJVYXBTEBAZES-LJQANCHMSA-N |
| XLogP | 3.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|