C15H21F2N — CID 169245340
5-(difluoromethyl)-2-methylidene-1-[(E)-2-propan-2-ylpent-1-enyl]pyridine (PubChem CID 169245340) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is 5-(difluoromethyl)-2-methylidene-1-[(E)-2-propan-2-ylpent-1-enyl]pyridine.
| Compound Name | 5-(difluoromethyl)-2-methylidene-1-[(E)-2-propan-2-ylpent-1-enyl]pyridine |
|---|---|
| PubChem CID | 169245340 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 5-(difluoromethyl)-2-methylidene-1-[(E)-2-propan-2-ylpent-1-enyl]pyridine |
| SMILES | C=C1C=CC(C(F)F)=CN1/C=C(\CCC)C(C)C |
| InChI | InChI=1S/C15H21F2N/c1-5-6-13(11(2)3)9-18-10-14(15(16)17)8-7-12(18)4/h7-11,15H,4-6H2,1-3H3/b13-9+ |
| InChIKey | AYSJDEQVXBWOMP-UKTHLTGXSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |