C23H32ClFN6O — CID 169254771
2-[(7R)-11-chloro-7-ethyl-12-fluoro-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-6-yl]-N-ethylethanamine (PubChem CID 169254771) has the molecular formula C23H32ClFN6O and a molecular weight of 463.00 g/mol. Its IUPAC name is 2-[(7R)-11-chloro-7-ethyl-12-fluoro-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-6-yl]-N-ethylethanamine.
| Compound Name | 2-[(7R)-11-chloro-7-ethyl-12-fluoro-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-6-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 169254771 |
| Molecular Formula | C23H32ClFN6O |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[(7R)-11-chloro-7-ethyl-12-fluoro-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-6-yl]-N-ethylethanamine |
| SMILES | CCNCCN1c2nc(OCC34CCCN3CCC4)nc3c(F)c(Cl)nc(c23)C[C@H]1CC |
| InChI | InChI=1S/C23H32ClFN6O/c1-3-15-13-16-17-19(18(25)20(24)27-16)28-22(29-21(17)31(15)12-9-26-4-2)32-14-23-7-5-10-30(23)11-6-8-23/h15,26H,3-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | GVYGONPHKOEDOO-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|