C18H19F3N2OS2 — CID 169263153
2-tert-butyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-thieno[3,2-d][1,2]thiazole-5-carboxamide (PubChem CID 169263153) has the molecular formula C18H19F3N2OS2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-tert-butyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-thieno[3,2-d][1,2]thiazole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-thieno[3,2-d][1,2]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 169263153 |
| Molecular Formula | C18H19F3N2OS2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-tert-butyl-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-thieno[3,2-d][1,2]thiazole-5-carboxamide |
| SMILES | CC(C)(C)N1Cc2cc(C(=O)NCc3ccc(C(F)(F)F)cc3)sc2S1 |
| InChI | InChI=1S/C18H19F3N2OS2/c1-17(2,3)23-10-12-8-14(25-16(12)26-23)15(24)22-9-11-4-6-13(7-5-11)18(19,20)21/h4-8H,9-10H2,1-3H3,(H,22,24) |
| InChIKey | MHKNFASZMLBSQJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|