C12H13N5O — CID 169263170
(E)-1-[(Z)-[(Z)-2-([1,2,4]triazolo[4,3-a]pyrazin-6-yl)but-2-enylidene]amino]prop-1-en-1-ol (PubChem CID 169263170) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is (E)-1-[(Z)-[(Z)-2-([1,2,4]triazolo[4,3-a]pyrazin-6-yl)but-2-enylidene]amino]prop-1-en-1-ol.
| Compound Name | (E)-1-[(Z)-[(Z)-2-([1,2,4]triazolo[4,3-a]pyrazin-6-yl)but-2-enylidene]amino]prop-1-en-1-ol |
|---|---|
| PubChem CID | 169263170 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (E)-1-[(Z)-[(Z)-2-([1,2,4]triazolo[4,3-a]pyrazin-6-yl)but-2-enylidene]amino]prop-1-en-1-ol |
| SMILES | C/C=C(\C=N/C(O)=C\C)c1cn2cnnc2cn1 |
| InChI | InChI=1S/C12H13N5O/c1-3-9(5-14-12(18)4-2)10-7-17-8-15-16-11(17)6-13-10/h3-8,18H,1-2H3/b9-3+,12-4+,14-5- |
| InChIKey | TVDJOSVNCUETJP-BDULMWNKSA-N |
| XLogP | 2.02 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|