C22H13FN2O2S — CID 169263906
8-benzylsulfanyl-3-fluoroindolo[2,1-b]quinazoline-6,12-dione (PubChem CID 169263906) has the molecular formula C22H13FN2O2S and a molecular weight of 388.42 g/mol. Its IUPAC name is 8-benzylsulfanyl-3-fluoroindolo[2,1-b]quinazoline-6,12-dione.
| Compound Name | 8-benzylsulfanyl-3-fluoroindolo[2,1-b]quinazoline-6,12-dione |
|---|---|
| PubChem CID | 169263906 |
| Molecular Formula | C22H13FN2O2S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 8-benzylsulfanyl-3-fluoroindolo[2,1-b]quinazoline-6,12-dione |
| SMILES | O=C1c2cc(SCc3ccccc3)ccc2-n2c1nc1cc(F)ccc1c2=O |
| InChI | InChI=1S/C22H13FN2O2S/c23-14-6-8-16-18(10-14)24-21-20(26)17-11-15(7-9-19(17)25(21)22(16)27)28-12-13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | HXNJCVCLQPTFHR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |