C15H19N3 — CID 169265960
ethane;11-propan-2-yl-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene (PubChem CID 169265960) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is ethane;11-propan-2-yl-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene.
| Compound Name | ethane;11-propan-2-yl-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 169265960 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | ethane;11-propan-2-yl-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene |
| SMILES | CC.CC(C)c1ccn2c(c1)nc1ncccc12 |
| InChI | InChI=1S/C13H13N3.C2H6/c1-9(2)10-5-7-16-11-4-3-6-14-13(11)15-12(16)8-10;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | JIEBEBBQEJCANT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |