C12H14BIN2O4 — CID 169268663
[3-iodo-4-[2-(prop-2-enoylamino)ethylcarbamoyl]phenyl]boronic acid (PubChem CID 169268663) has the molecular formula C12H14BIN2O4 and a molecular weight of 387.97 g/mol. Its IUPAC name is [3-iodo-4-[2-(prop-2-enoylamino)ethylcarbamoyl]phenyl]boronic acid.
| Compound Name | [3-iodo-4-[2-(prop-2-enoylamino)ethylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169268663 |
| Molecular Formula | C12H14BIN2O4 |
| Molecular Weight | 387.97 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [3-iodo-4-[2-(prop-2-enoylamino)ethylcarbamoyl]phenyl]boronic acid |
| SMILES | C=CC(=O)NCCNC(=O)c1ccc(B(O)O)cc1I |
| InChI | InChI=1S/C12H14BIN2O4/c1-2-11(17)15-5-6-16-12(18)9-4-3-8(13(19)20)7-10(9)14/h2-4,7,19-20H,1,5-6H2,(H,15,17)(H,16,18) |
| InChIKey | QEGBZMUKFNWUKQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.97 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|