C13H7N2O2- — CID 169275668
3-[4-[(E)-2-cyano-2-isocyanoethenyl]phenyl]-1-hydroxyprop-2-yn-1-olate (PubChem CID 169275668) has the molecular formula C13H7N2O2- and a molecular weight of 223.21 g/mol. Its IUPAC name is 3-[4-[(E)-2-cyano-2-isocyanoethenyl]phenyl]-1-hydroxyprop-2-yn-1-olate.
| Compound Name | 3-[4-[(E)-2-cyano-2-isocyanoethenyl]phenyl]-1-hydroxyprop-2-yn-1-olate |
|---|---|
| PubChem CID | 169275668 |
| Molecular Formula | C13H7N2O2- |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-[4-[(E)-2-cyano-2-isocyanoethenyl]phenyl]-1-hydroxyprop-2-yn-1-olate |
| SMILES | [C-]#[N+]/C(C#N)=C/c1ccc(C#CC([O-])O)cc1 |
| InChI | InChI=1S/C13H7N2O2/c1-15-12(9-14)8-11-4-2-10(3-5-11)6-7-13(16)17/h2-5,8,13,16H/q-1/b12-8+ |
| InChIKey | QSQRAJTXWAXOCT-XYOKQWHBSA-N |
| XLogP | 0.50 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|