C30H16N6S2 — CID 123387525
(E)-3-[2-[(Z)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-bis(sulfanylidene)quinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 123387525) has the molecular formula C30H16N6S2 and a molecular weight of 524.63 g/mol. Its IUPAC name is (E)-3-[2-[(Z)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-bis(sulfanylidene)quinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (E)-3-[2-[(Z)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-bis(sulfanylidene)quinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 123387525 |
| Molecular Formula | C30H16N6S2 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | (E)-3-[2-[(Z)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-bis(sulfanylidene)quinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc2c(c1)c(=S)c1cc3c(cc1n2C)c(=S)c1cc(/C=C(\C#N)[N+]#[C-])ccc1n3C |
| InChI | InChI=1S/C30H16N6S2/c1-33-19(15-31)9-17-5-7-25-21(11-17)29(37)23-13-28-24(14-27(23)35(25)3)30(38)22-12-18(10-20(16-32)34-2)6-8-26(22)36(28)4/h5-14H,3-4H3/b19-9-,20-10+ |
| InChIKey | BLCJUDVSYOILIO-KFSYKRRRSA-N |
| XLogP | 8.00 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|