C64H40N12O4 — CID 159114857
(Z)-3-[2-[(E)-1-cyano-1-isocyanoprop-1-en-2-yl]-5,12-dimethyl-7,14-dioxoquinolino[2,3-b]acridin-9-yl]-2-isocyanobut-2-enenitrile (PubChem CID 159114857) has the molecular formula C64H40N12O4 and a molecular weight of 1041.10 g/mol. Its IUPAC name is (Z)-3-[2-[(E)-1-cyano-1-isocyanoprop-1-en-2-yl]-5,12-dimethyl-7,14-dioxoquinolino[2,3-b]acridin-9-yl]-2-isocyanobut-2-enenitrile.
| Compound Name | (Z)-3-[2-[(E)-1-cyano-1-isocyanoprop-1-en-2-yl]-5,12-dimethyl-7,14-dioxoquinolino[2,3-b]acridin-9-yl]-2-isocyanobut-2-enenitrile |
|---|---|
| PubChem CID | 159114857 |
| Molecular Formula | C64H40N12O4 |
| Molecular Weight | 1041.10 g/mol |
| Exact Mass | 1040.33 |
| IUPAC Name | (Z)-3-[2-[(E)-1-cyano-1-isocyanoprop-1-en-2-yl]-5,12-dimethyl-7,14-dioxoquinolino[2,3-b]acridin-9-yl]-2-isocyanobut-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/C)c1ccc2c(c1)c(=O)c1cc3c(cc1n2C)c(=O)c1cc(/C(C)=C(\C#N)[N+]#[C-])ccc1n3C.[C-]#[N+]/C(C#N)=C(/C)c1ccc2c(c1)c(=O)c1cc3c(cc1n2C)c(=O)c1cc(/C(C)=C(\C#N)[N+]#[C-])ccc1n3C |
| InChI | InChI=1S/2C32H20N6O2/c2*1-17(25(15-33)35-3)19-7-9-27-21(11-19)31(39)23-13-30-24(14-29(23)37(27)5)32(40)22-12-20(8-10-28(22)38(30)6)18(2)26(16-34)36-4/h2*7-14H,1-2,5-6H3/b2*25-17-,26-18+ |
| InChIKey | KEYMUIHCMZILIN-NAIVXZGUSA-N |
| XLogP | 12.09 |
| TPSA | 200.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.10 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|