C31H17N5O2 — CID 123334849
(Z)-3-[2-[(E)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-dioxo-12H-naphtho[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 123334849) has the molecular formula C31H17N5O2 and a molecular weight of 491.51 g/mol. Its IUPAC name is (Z)-3-[2-[(E)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-dioxo-12H-naphtho[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-3-[2-[(E)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-dioxo-12H-naphtho[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 123334849 |
| Molecular Formula | C31H17N5O2 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (Z)-3-[2-[(E)-2-cyano-2-isocyanoethenyl]-5,12-dimethyl-7,14-dioxo-12H-naphtho[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc2c(c1)C(=O)c1cc3c(cc1C2C)c(=O)c1cc(/C=C(\C#N)[N+]#[C-])ccc1n3C |
| InChI | InChI=1S/C31H17N5O2/c1-17-22-7-5-18(9-20(15-32)34-2)11-24(22)30(37)25-14-29-27(13-23(17)25)31(38)26-12-19(10-21(16-33)35-3)6-8-28(26)36(29)4/h5-14,17H,1,4H3/b20-9-,21-10+ |
| InChIKey | LDTHNYNJOPRYMR-QWHWCFICSA-N |
| XLogP | 5.96 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|