C36H16N10 — CID 123947445
(E)-3-[(7E,14Z)-2-[(Z)-2-cyano-2-isocyanoethenyl]-7,14-bis[cyano(isocyano)methylidene]-5,12-dimethylquinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 123947445) has the molecular formula C36H16N10 and a molecular weight of 588.59 g/mol. Its IUPAC name is (E)-3-[(7E,14Z)-2-[(Z)-2-cyano-2-isocyanoethenyl]-7,14-bis[cyano(isocyano)methylidene]-5,12-dimethylquinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (E)-3-[(7E,14Z)-2-[(Z)-2-cyano-2-isocyanoethenyl]-7,14-bis[cyano(isocyano)methylidene]-5,12-dimethylquinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 123947445 |
| Molecular Formula | C36H16N10 |
| Molecular Weight | 588.59 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | (E)-3-[(7E,14Z)-2-[(Z)-2-cyano-2-isocyanoethenyl]-7,14-bis[cyano(isocyano)methylidene]-5,12-dimethylquinolino[2,3-b]acridin-9-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc2c(c1)/C(=C(\C#N)[N+]#[C-])c1cc3c(cc1N2C)/C(=C(\C#N)[N+]#[C-])c1cc(/C=C(\C#N)[N+]#[C-])ccc1N3C |
| InChI | InChI=1S/C36H16N10/c1-41-23(17-37)11-21-7-9-31-25(13-21)35(29(19-39)43-3)27-15-34-28(16-33(27)45(31)5)36(30(20-40)44-4)26-14-22(12-24(18-38)42-2)8-10-32(26)46(34)6/h7-16H,5-6H3/b23-11-,24-12+,35-29-,36-30+ |
| InChIKey | DSUFUHFQTQNMEW-JMVSXOGUSA-N |
| XLogP | 7.82 |
| TPSA | 119.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|