C41H80O6 — CID 169276866
[3-(10-hydroxyoctadecanoyloxy)-2,2-dimethylpropyl] 10-hydroxyoctadecanoate (PubChem CID 169276866) has the molecular formula C41H80O6 and a molecular weight of 669.09 g/mol. Its IUPAC name is [3-(10-hydroxyoctadecanoyloxy)-2,2-dimethylpropyl] 10-hydroxyoctadecanoate.
| Compound Name | [3-(10-hydroxyoctadecanoyloxy)-2,2-dimethylpropyl] 10-hydroxyoctadecanoate |
|---|---|
| PubChem CID | 169276866 |
| Molecular Formula | C41H80O6 |
| Molecular Weight | 669.09 g/mol |
| Exact Mass | 668.60 |
| IUPAC Name | [3-(10-hydroxyoctadecanoyloxy)-2,2-dimethylpropyl] 10-hydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)CCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCCC(O)CCCCCCCC |
| InChI | InChI=1S/C41H80O6/c1-5-7-9-11-17-23-29-37(42)31-25-19-13-15-21-27-33-39(44)46-35-41(3,4)36-47-40(45)34-28-22-16-14-20-26-32-38(43)30-24-18-12-10-8-6-2/h37-38,42-43H,5-36H2,1-4H3 |
| InChIKey | HHAAMFDEJUNPGS-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.09 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|