C23H21FN4O — CID 169279408
2-fluoro-5-[(1R,2S,13R,14R,15S)-10-methoxy-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]benzonitrile (PubChem CID 169279408) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-fluoro-5-[(1R,2S,13R,14R,15S)-10-methoxy-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]benzonitrile.
| Compound Name | 2-fluoro-5-[(1R,2S,13R,14R,15S)-10-methoxy-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]benzonitrile |
|---|---|
| PubChem CID | 169279408 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-fluoro-5-[(1R,2S,13R,14R,15S)-10-methoxy-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3,5,8,10-tetraen-13-yl]benzonitrile |
| SMILES | COc1cc2[nH]ncc2c2c1N[C@@H](c1ccc(F)c(C#N)c1)[C@@H]1[C@H]3CC[C@H](C3)[C@H]21 |
| InChI | InChI=1S/C23H21FN4O/c1-29-18-8-17-15(10-26-28-17)21-19-11-2-3-12(6-11)20(19)22(27-23(18)21)13-4-5-16(24)14(7-13)9-25/h4-5,7-8,10-12,19-20,22,27H,2-3,6H2,1H3,(H,26,28)/t11-,12+,19+,20-,22+/m1/s1 |
| InChIKey | RJZURBDVTNDXBU-RBDKJMMQSA-N |
| XLogP | 4.88 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |