C13H14F2 — CID 169282398
1,3-difluoro-5-[(1R)-1-methylcyclohex-2-en-1-yl]benzene (PubChem CID 169282398) has the molecular formula C13H14F2 and a molecular weight of 208.25 g/mol. Its IUPAC name is 1,3-difluoro-5-[(1R)-1-methylcyclohex-2-en-1-yl]benzene.
| Compound Name | 1,3-difluoro-5-[(1R)-1-methylcyclohex-2-en-1-yl]benzene |
|---|---|
| PubChem CID | 169282398 |
| Molecular Formula | C13H14F2 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1,3-difluoro-5-[(1R)-1-methylcyclohex-2-en-1-yl]benzene |
| SMILES | C[C@]1(c2cc(F)cc(F)c2)C=CCCC1 |
| InChI | InChI=1S/C13H14F2/c1-13(5-3-2-4-6-13)10-7-11(14)9-12(15)8-10/h3,5,7-9H,2,4,6H2,1H3/t13-/m0/s1 |
| InChIKey | XJZVFHBPWMSMJJ-ZDUSSCGKSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|