C14H14F4 — CID 169282467
(3R)-3-methyl-3-(2,3,5,6-tetrafluorophenyl)cycloheptene (PubChem CID 169282467) has the molecular formula C14H14F4 and a molecular weight of 258.26 g/mol. Its IUPAC name is (3R)-3-methyl-3-(2,3,5,6-tetrafluorophenyl)cycloheptene.
| Compound Name | (3R)-3-methyl-3-(2,3,5,6-tetrafluorophenyl)cycloheptene |
|---|---|
| PubChem CID | 169282467 |
| Molecular Formula | C14H14F4 |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (3R)-3-methyl-3-(2,3,5,6-tetrafluorophenyl)cycloheptene |
| SMILES | C[C@]1(c2c(F)c(F)cc(F)c2F)C=CCCCC1 |
| InChI | InChI=1S/C14H14F4/c1-14(6-4-2-3-5-7-14)11-12(17)9(15)8-10(16)13(11)18/h4,6,8H,2-3,5,7H2,1H3/t14-/m0/s1 |
| InChIKey | UYNOKXVHTNWZFB-AWEZNQCLSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|