C13H12F4 — CID 169282440
1,2,4,5-tetrafluoro-3-[(1R)-1-methylcyclohex-2-en-1-yl]benzene (PubChem CID 169282440) has the molecular formula C13H12F4 and a molecular weight of 244.23 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[(1R)-1-methylcyclohex-2-en-1-yl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[(1R)-1-methylcyclohex-2-en-1-yl]benzene |
|---|---|
| PubChem CID | 169282440 |
| Molecular Formula | C13H12F4 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[(1R)-1-methylcyclohex-2-en-1-yl]benzene |
| SMILES | C[C@]1(c2c(F)c(F)cc(F)c2F)C=CCCC1 |
| InChI | InChI=1S/C13H12F4/c1-13(5-3-2-4-6-13)10-11(16)8(14)7-9(15)12(10)17/h3,5,7H,2,4,6H2,1H3/t13-/m0/s1 |
| InChIKey | UDEKGJDHCMUTDJ-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|