C54H47N3 — CID 169286094
N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-9-ethyl-6-isocyano-N-phenylcarbazol-3-amine (PubChem CID 169286094) has the molecular formula C54H47N3 and a molecular weight of 737.99 g/mol. Its IUPAC name is N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-9-ethyl-6-isocyano-N-phenylcarbazol-3-amine.
| Compound Name | N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-9-ethyl-6-isocyano-N-phenylcarbazol-3-amine |
|---|---|
| PubChem CID | 169286094 |
| Molecular Formula | C54H47N3 |
| Molecular Weight | 737.99 g/mol |
| Exact Mass | 737.38 |
| IUPAC Name | N-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-9-ethyl-6-isocyano-N-phenylcarbazol-3-amine |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(N(c3ccccc3)c3ccc4c(c3)C3(c5ccccc5-4)c4cc(C(C)(C)C)ccc4-c4ccc(C(C)(C)C)cc43)ccc1n2CC |
| InChI | InChI=1S/C54H47N3/c1-9-56-50-27-21-36(55-8)31-44(50)45-32-38(23-28-51(45)56)57(37-15-11-10-12-16-37)39-22-26-43-40-17-13-14-18-46(40)54(49(43)33-39)47-29-34(52(2,3)4)19-24-41(47)42-25-20-35(30-48(42)54)53(5,6)7/h10-33H,9H2,1-7H3 |
| InChIKey | YWEGAIHRWMDZAR-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.99 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|