C15H27NP2 — CID 169286153
4-nonyl-N,N-bis(phosphanyl)aniline (PubChem CID 169286153) has the molecular formula C15H27NP2 and a molecular weight of 283.34 g/mol. Its IUPAC name is 4-nonyl-N,N-bis(phosphanyl)aniline.
| Compound Name | 4-nonyl-N,N-bis(phosphanyl)aniline |
|---|---|
| PubChem CID | 169286153 |
| Molecular Formula | C15H27NP2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-nonyl-N,N-bis(phosphanyl)aniline |
| SMILES | CCCCCCCCCc1ccc(N(P)P)cc1 |
| InChI | InChI=1S/C15H27NP2/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)16(17)18/h10-13H,2-9,17-18H2,1H3 |
| InChIKey | ULMPNJFENWMWNW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|