C13H23NP2 — CID 169286189
4-heptyl-N,N-bis(phosphanyl)aniline (PubChem CID 169286189) has the molecular formula C13H23NP2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-heptyl-N,N-bis(phosphanyl)aniline.
| Compound Name | 4-heptyl-N,N-bis(phosphanyl)aniline |
|---|---|
| PubChem CID | 169286189 |
| Molecular Formula | C13H23NP2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-heptyl-N,N-bis(phosphanyl)aniline |
| SMILES | CCCCCCCc1ccc(N(P)P)cc1 |
| InChI | InChI=1S/C13H23NP2/c1-2-3-4-5-6-7-12-8-10-13(11-9-12)14(15)16/h8-11H,2-7,15-16H2,1H3 |
| InChIKey | FOLHLUCQZUHGIU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|