C15H19NP2 — CID 169286170
N,N-bis(phosphanyl)-4-(4-propylphenyl)aniline (PubChem CID 169286170) has the molecular formula C15H19NP2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N,N-bis(phosphanyl)-4-(4-propylphenyl)aniline.
| Compound Name | N,N-bis(phosphanyl)-4-(4-propylphenyl)aniline |
|---|---|
| PubChem CID | 169286170 |
| Molecular Formula | C15H19NP2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N,N-bis(phosphanyl)-4-(4-propylphenyl)aniline |
| SMILES | CCCc1ccc(-c2ccc(N(P)P)cc2)cc1 |
| InChI | InChI=1S/C15H19NP2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h4-11H,2-3,17-18H2,1H3 |
| InChIKey | OPTVJNAHRCVOAS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|