C23H42N2O6 — CID 169289833
2-[2-[[(3R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxycarbonylamino]ethoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 169289833) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-[2-[[(3R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxycarbonylamino]ethoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[[(3R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxycarbonylamino]ethoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 169289833 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 2-[2-[[(3R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxycarbonylamino]ethoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OCC12CCCN1[C@@H](COC(=O)NCCOCCOC(=O)C(C)(C)C)CC2 |
| InChI | InChI=1S/C23H42N2O6/c1-21(2,3)19(26)29-15-14-28-13-11-24-20(27)30-16-18-8-10-23(9-7-12-25(18)23)17-31-22(4,5)6/h18H,7-17H2,1-6H3,(H,24,27)/t18-,23?/m1/s1 |
| InChIKey | DEXWDQUOTCVFIR-FKSKYRLFSA-N |
| XLogP | 3.13 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|