C25H45N5O3 — CID 169289910
4,4-dimethyl-1-[2-[4-[[(3R,8R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxymethyl]triazol-1-yl]ethylamino]pentan-3-one (PubChem CID 169289910) has the molecular formula C25H45N5O3 and a molecular weight of 463.67 g/mol. Its IUPAC name is 4,4-dimethyl-1-[2-[4-[[(3R,8R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxymethyl]triazol-1-yl]ethylamino]pentan-3-one.
| Compound Name | 4,4-dimethyl-1-[2-[4-[[(3R,8R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxymethyl]triazol-1-yl]ethylamino]pentan-3-one |
|---|---|
| PubChem CID | 169289910 |
| Molecular Formula | C25H45N5O3 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 4,4-dimethyl-1-[2-[4-[[(3R,8R)-8-[(2-methylpropan-2-yl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methoxymethyl]triazol-1-yl]ethylamino]pentan-3-one |
| SMILES | CC(C)(C)OC[C@]12CCCN1[C@@H](COCc1cn(CCNCCC(=O)C(C)(C)C)nn1)CC2 |
| InChI | InChI=1S/C25H45N5O3/c1-23(2,3)22(31)9-12-26-13-15-29-16-20(27-28-29)17-32-18-21-8-11-25(10-7-14-30(21)25)19-33-24(4,5)6/h16,21,26H,7-15,17-19H2,1-6H3/t21-,25-/m1/s1 |
| InChIKey | JRDRMBDNKFXLQU-PXDATVDWSA-N |
| XLogP | 3.20 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|