C11H8N4O2S — CID 169290623
5-isocyano-2-nitro-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 169290623) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 5-isocyano-2-nitro-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 5-isocyano-2-nitro-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 169290623 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 5-isocyano-2-nitro-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | [C-]#[N+]c1ccc([N+](=O)[O-])c(NCc2cncs2)c1 |
| InChI | InChI=1S/C11H8N4O2S/c1-12-8-2-3-11(15(16)17)10(4-8)14-6-9-5-13-7-18-9/h2-5,7,14H,6H2 |
| InChIKey | MWXIVDUMNAAEIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|